Diethyltryptamine
From Freepedia
| DET | |
|---|---|
| Chemical formula | C14H20N2 |
| Molecular mass | 216.32 g/mol |
| SMILES | CCN(CC)CCC1=CNC2=C1C=CC=C2 |
| Image:DET.png | |
DET or diethyl-tryptamine is an orally active hallucinogenic drug and psychedelic compound of moderate duration. DET is a substituted tryptamine, structurally similar to DMT and dipropyltryptamine (DPT).
See also
External links
| Psychedelic tryptamines |
|---|
|
5-MeO-AMT | 5-MeO-DIPT | 5-MeO-DMT | AMT | Bufotenin | DET | DIPT | DMT | DPT | Ethocin | Iprocin | Psilocin | Psilocybin |
| Tryptamines |
|---|
|
4-Acetoxy-DET | 4-Acetoxy-DIPT | 5-MeO-AMT | 5-MeO-DALT | 5-MeO-DET | 5-MeO-DIPT | 5-MeO-DMT | 5-MeO-MIPT | AET | AMT | Baeocystin | Bufotenin | DET | DIPT | DMT | DPT | Ethocin | Ibogaine | Iprocin | Melatonin | Norbaeocystin | Psilocin | Psilocybin | Rizatriptan | Serotonin | Sumatriptan | Tryptamine | Tryptophan |



